C14H21N7O — CID 128519257
3-ethyl-N-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)triazole-4-carboxamide (PubChem CID 128519257) has the molecular formula C14H21N7O and a molecular weight of 303.37 g/mol. Its IUPAC name is 3-ethyl-N-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)triazole-4-carboxamide.
| Compound Name | 3-ethyl-N-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 128519257 |
| Molecular Formula | C14H21N7O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 3-ethyl-N-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)triazole-4-carboxamide |
| SMILES | CCn1nncc1C(=O)NC1CCc2nc(C(C)C)nn2C1 |
| InChI | InChI=1S/C14H21N7O/c1-4-20-11(7-15-19-20)14(22)16-10-5-6-12-17-13(9(2)3)18-21(12)8-10/h7,9-10H,4-6,8H2,1-3H3,(H,16,22) |
| InChIKey | BXHKROIXRPBBJA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |