C23H19F3O6S — CID 12852233
benzenesulfonylmethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate (PubChem CID 12852233) has the molecular formula C23H19F3O6S and a molecular weight of 480.46 g/mol. Its IUPAC name is benzenesulfonylmethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate.
| Compound Name | benzenesulfonylmethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 12852233 |
| Molecular Formula | C23H19F3O6S |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | benzenesulfonylmethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate |
| SMILES | CC(Oc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1)C(=O)OCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19F3O6S/c1-16(22(27)30-15-33(28,29)21-5-3-2-4-6-21)31-18-11-13-20(14-12-18)32-19-9-7-17(8-10-19)23(24,25)26/h2-14,16H,15H2,1H3 |
| InChIKey | RQMXJARKCURACC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |