C9H8FN5 — CID 12852432
6-(3-fluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 12852432) has the molecular formula C9H8FN5 and a molecular weight of 205.20 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3-fluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 12852432 |
| Molecular Formula | C9H8FN5 |
| Molecular Weight | 205.20 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | 6-(3-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C9H8FN5/c10-6-3-1-2-5(4-6)7-13-8(11)15-9(12)14-7/h1-4H,(H4,11,12,13,14,15) |
| InChIKey | OHGKSRVADPIOLJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |