C9H7BrFN5 — CID 12852443
6-(2-bromo-5-fluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 12852443) has the molecular formula C9H7BrFN5 and a molecular weight of 284.09 g/mol. Its IUPAC name is 6-(2-bromo-5-fluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-bromo-5-fluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 12852443 |
| Molecular Formula | C9H7BrFN5 |
| Molecular Weight | 284.09 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 6-(2-bromo-5-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2cc(F)ccc2Br)n1 |
| InChI | InChI=1S/C9H7BrFN5/c10-6-2-1-4(11)3-5(6)7-14-8(12)16-9(13)15-7/h1-3H,(H4,12,13,14,15,16) |
| InChIKey | JQZNVFAIZLQEKI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.09 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |