About 2-(hydroxymethyl)-1-[(4-phenylphenyl)methyl]piperidine-3,4,5-triol
2-(hydroxymethyl)-1-[(4-phenylphenyl)methyl]piperidine-3,4,5-triol (PubChem CID 12852784) has the molecular formula C19H23NO4
and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1-[(4-phenylphenyl)methyl]piperidine-3,4,5-triol.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-1-[(4-phenylphenyl)methyl]piperidine-3,4,5-triol |
| PubChem CID | 12852784 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-(hydroxymethyl)-1-[(4-phenylphenyl)methyl]piperidine-3,4,5-triol |
| SMILES | OCC1C(O)C(O)C(O)CN1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO4/c21-12-16-18(23)19(24)17(22)11-20(16)10-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-9,16-19,21-24H,10-12H2 |
| InChIKey | BSFDXOMBLXQZFY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(hydroxymethyl)-1-[(4-phenylphenyl)methyl]piperidine-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-1-[(4-phenylphenyl)methyl]piperidine-3,4,5-triol?
The IUPAC name of 2-(hydroxymethyl)-1-[(4-phenylphenyl)methyl]piperidine-3,4,5-triol (CID 12852784) is 2-(hydroxymethyl)-1-[(4-phenylphenyl)methyl]piperidine-3,4,5-triol.
What is the SMILES notation for 2-(hydroxymethyl)-1-[(4-phenylphenyl)methyl]piperidine-3,4,5-triol?
The canonical SMILES for 2-(hydroxymethyl)-1-[(4-phenylphenyl)methyl]piperidine-3,4,5-triol is OCC1C(O)C(O)C(O)CN1Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 2-(hydroxymethyl)-1-[(4-phenylphenyl)methyl]piperidine-3,4,5-triol?
The InChIKey is BSFDXOMBLXQZFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO4/c21-12-16-18(23)19(24)17(22)11-20(16)10-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-9,16-19,21-24H,10-12H2.
What are the key properties of 2-(hydroxymethyl)-1-[(4-phenylphenyl)methyl]piperidine-3,4,5-triol?
2-(hydroxymethyl)-1-[(4-phenylphenyl)methyl]piperidine-3,4,5-triol has a molecular weight of 329.40 g/mol, XLogP of 0.61, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-1-[(4-phenylphenyl)methyl]piperidine-3,4,5-triol is sourced from PubChem (CID 12852784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).