C13H22N2O — CID 128529431
N-cyclopropyl-3,3-dimethyl-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxamide (PubChem CID 128529431) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N-cyclopropyl-3,3-dimethyl-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxamide.
| Compound Name | N-cyclopropyl-3,3-dimethyl-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 128529431 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N-cyclopropyl-3,3-dimethyl-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxamide |
| SMILES | CC1(C)CN(C(=O)NC2CC2)C2CCCC21 |
| InChI | InChI=1S/C13H22N2O/c1-13(2)8-15(11-5-3-4-10(11)13)12(16)14-9-6-7-9/h9-11H,3-8H2,1-2H3,(H,14,16) |
| InChIKey | HZBKBPKHOFIYPW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |