silver 2,4-dioxo-1H-pyrimidine-6-carboxylate

C5H3AgN2O4 — CID 12853056

IUPACsilver 2,4-dioxo-1H-pyrimidine-6-carboxylate
SMILESO=C([O-])c1cc(=O)[nH]c(=O)[nH]1.[Ag+]
InChIInChI=1S/C5H4N2O4.Ag/c8-3-1-2(4(9)10)6-5(11)7-3;/h1H,(H,9,10)(H2,6,7,8,11);/q;+1/p-1
InChIKeyCQDUOMMCNFHUTP-UHFFFAOYSA-M
MW262.96 g/mol
LogP-2.58
Rot. Bonds1

About silver 2,4-dioxo-1H-pyrimidine-6-carboxylate

silver 2,4-dioxo-1H-pyrimidine-6-carboxylate (PubChem CID 12853056) has the molecular formula C5H3AgN2O4 and a molecular weight of 262.96 g/mol. Its IUPAC name is silver 2,4-dioxo-1H-pyrimidine-6-carboxylate.

Molecular Properties

Compound Namesilver 2,4-dioxo-1H-pyrimidine-6-carboxylate
PubChem CID12853056
Molecular FormulaC5H3AgN2O4
Molecular Weight262.96 g/mol
Exact Mass261.91
IUPAC Namesilver 2,4-dioxo-1H-pyrimidine-6-carboxylate
SMILESO=C([O-])c1cc(=O)[nH]c(=O)[nH]1.[Ag+]
InChIInChI=1S/C5H4N2O4.Ag/c8-3-1-2(4(9)10)6-5(11)7-3;/h1H,(H,9,10)(H2,6,7,8,11);/q;+1/p-1
InChIKeyCQDUOMMCNFHUTP-UHFFFAOYSA-M
XLogP-2.58
TPSA105.85 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.96
LogP ≤ 5-2.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze silver 2,4-dioxo-1H-pyrimidine-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of silver 2,4-dioxo-1H-pyrimidine-6-carboxylate?
The IUPAC name of silver 2,4-dioxo-1H-pyrimidine-6-carboxylate (CID 12853056) is silver 2,4-dioxo-1H-pyrimidine-6-carboxylate.
What is the SMILES notation for silver 2,4-dioxo-1H-pyrimidine-6-carboxylate?
The canonical SMILES for silver 2,4-dioxo-1H-pyrimidine-6-carboxylate is O=C([O-])c1cc(=O)[nH]c(=O)[nH]1.[Ag+].
What is the InChIKey of silver 2,4-dioxo-1H-pyrimidine-6-carboxylate?
The InChIKey is CQDUOMMCNFHUTP-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H4N2O4.Ag/c8-3-1-2(4(9)10)6-5(11)7-3;/h1H,(H,9,10)(H2,6,7,8,11);/q;+1/p-1.
What are the key properties of silver 2,4-dioxo-1H-pyrimidine-6-carboxylate?
silver 2,4-dioxo-1H-pyrimidine-6-carboxylate has a molecular weight of 262.96 g/mol, XLogP of -2.58, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for silver 2,4-dioxo-1H-pyrimidine-6-carboxylate is sourced from PubChem (CID 12853056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).