About N,N-di(cyclobutyl)-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide
N,N-di(cyclobutyl)-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 128533423) has the molecular formula C16H18N4OS
and a molecular weight of 314.41 g/mol. Its IUPAC name is N,N-di(cyclobutyl)-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N,N-di(cyclobutyl)-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide |
| PubChem CID | 128533423 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N,N-di(cyclobutyl)-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | O=C(c1cnc(-c2ncccn2)s1)N(C1CCC1)C1CCC1 |
| InChI | InChI=1S/C16H18N4OS/c21-16(20(11-4-1-5-11)12-6-2-7-12)13-10-19-15(22-13)14-17-8-3-9-18-14/h3,8-12H,1-2,4-7H2 |
| InChIKey | LUGVQCLFJQXBPY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-di(cyclobutyl)-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-di(cyclobutyl)-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide?
The IUPAC name of N,N-di(cyclobutyl)-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide (CID 128533423) is N,N-di(cyclobutyl)-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N,N-di(cyclobutyl)-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N,N-di(cyclobutyl)-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide is O=C(c1cnc(-c2ncccn2)s1)N(C1CCC1)C1CCC1.
What is the InChIKey of N,N-di(cyclobutyl)-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide?
The InChIKey is LUGVQCLFJQXBPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4OS/c21-16(20(11-4-1-5-11)12-6-2-7-12)13-10-19-15(22-13)14-17-8-3-9-18-14/h3,8-12H,1-2,4-7H2.
What are the key properties of N,N-di(cyclobutyl)-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide?
N,N-di(cyclobutyl)-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide has a molecular weight of 314.41 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-di(cyclobutyl)-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 128533423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).