About 4-[2-(1,1-dioxothian-3-yl)acetyl]-3-(2-methylpropyl)-1,4-diazepan-2-one
4-[2-(1,1-dioxothian-3-yl)acetyl]-3-(2-methylpropyl)-1,4-diazepan-2-one (PubChem CID 128535363) has the molecular formula C16H28N2O4S
and a molecular weight of 344.48 g/mol. Its IUPAC name is 4-[2-(1,1-dioxothian-3-yl)acetyl]-3-(2-methylpropyl)-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 4-[2-(1,1-dioxothian-3-yl)acetyl]-3-(2-methylpropyl)-1,4-diazepan-2-one |
| PubChem CID | 128535363 |
| Molecular Formula | C16H28N2O4S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 4-[2-(1,1-dioxothian-3-yl)acetyl]-3-(2-methylpropyl)-1,4-diazepan-2-one |
| SMILES | CC(C)CC1C(=O)NCCCN1C(=O)CC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H28N2O4S/c1-12(2)9-14-16(20)17-6-4-7-18(14)15(19)10-13-5-3-8-23(21,22)11-13/h12-14H,3-11H2,1-2H3,(H,17,20) |
| InChIKey | ZDPWUPKYDCXSPF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(1,1-dioxothian-3-yl)acetyl]-3-(2-methylpropyl)-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,1-dioxothian-3-yl)acetyl]-3-(2-methylpropyl)-1,4-diazepan-2-one?
The IUPAC name of 4-[2-(1,1-dioxothian-3-yl)acetyl]-3-(2-methylpropyl)-1,4-diazepan-2-one (CID 128535363) is 4-[2-(1,1-dioxothian-3-yl)acetyl]-3-(2-methylpropyl)-1,4-diazepan-2-one.
What is the SMILES notation for 4-[2-(1,1-dioxothian-3-yl)acetyl]-3-(2-methylpropyl)-1,4-diazepan-2-one?
The canonical SMILES for 4-[2-(1,1-dioxothian-3-yl)acetyl]-3-(2-methylpropyl)-1,4-diazepan-2-one is CC(C)CC1C(=O)NCCCN1C(=O)CC1CCCS(=O)(=O)C1.
What is the InChIKey of 4-[2-(1,1-dioxothian-3-yl)acetyl]-3-(2-methylpropyl)-1,4-diazepan-2-one?
The InChIKey is ZDPWUPKYDCXSPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O4S/c1-12(2)9-14-16(20)17-6-4-7-18(14)15(19)10-13-5-3-8-23(21,22)11-13/h12-14H,3-11H2,1-2H3,(H,17,20).
What are the key properties of 4-[2-(1,1-dioxothian-3-yl)acetyl]-3-(2-methylpropyl)-1,4-diazepan-2-one?
4-[2-(1,1-dioxothian-3-yl)acetyl]-3-(2-methylpropyl)-1,4-diazepan-2-one has a molecular weight of 344.48 g/mol, XLogP of 0.96, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,1-dioxothian-3-yl)acetyl]-3-(2-methylpropyl)-1,4-diazepan-2-one is sourced from PubChem (CID 128535363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).