C36H38N2O3S2 — CID 12853577
3-[4-(3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl 2-hydroxy-2,2-diphenylacetate (PubChem CID 12853577) has the molecular formula C36H38N2O3S2 and a molecular weight of 610.85 g/mol. Its IUPAC name is 3-[4-(3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl 2-hydroxy-2,2-diphenylacetate.
| Compound Name | 3-[4-(3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 12853577 |
| Molecular Formula | C36H38N2O3S2 |
| Molecular Weight | 610.85 g/mol |
| Exact Mass | 610.23 |
| IUPAC Name | 3-[4-(3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl 2-hydroxy-2,2-diphenylacetate |
| SMILES | CSc1ccc2c(c1)C(N1CCN(CCCOC(=O)C(O)(c3ccccc3)c3ccccc3)CC1)Cc1ccccc1S2 |
| InChI | InChI=1S/C36H38N2O3S2/c1-42-30-17-18-34-31(26-30)32(25-27-11-8-9-16-33(27)43-34)38-22-20-37(21-23-38)19-10-24-41-35(39)36(40,28-12-4-2-5-13-28)29-14-6-3-7-15-29/h2-9,11-18,26,32,40H,10,19-25H2,1H3 |
| InChIKey | BCXCEEIRMUFCFO-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.85 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|