C11H22N2O3S — CID 12854295
tert-butyl N-(1-amino-3-ethylsulfanyl-1-oxopropan-2-yl)-N-methylcarbamate (PubChem CID 12854295) has the molecular formula C11H22N2O3S and a molecular weight of 262.38 g/mol. Its IUPAC name is tert-butyl N-(1-amino-3-ethylsulfanyl-1-oxopropan-2-yl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(1-amino-3-ethylsulfanyl-1-oxopropan-2-yl)-N-methylcarbamate |
|---|---|
| PubChem CID | 12854295 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | tert-butyl N-(1-amino-3-ethylsulfanyl-1-oxopropan-2-yl)-N-methylcarbamate |
| SMILES | CCSCC(C(N)=O)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22N2O3S/c1-6-17-7-8(9(12)14)13(5)10(15)16-11(2,3)4/h8H,6-7H2,1-5H3,(H2,12,14) |
| InChIKey | PZKSIQOYSXWANV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |