About 3-[(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methyl]-2,4-difluorophenol
3-[(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methyl]-2,4-difluorophenol (PubChem CID 128551230) has the molecular formula C15H19F2NO3S
and a molecular weight of 331.38 g/mol. Its IUPAC name is 3-[(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methyl]-2,4-difluorophenol.
Molecular Properties
| Compound Name | 3-[(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methyl]-2,4-difluorophenol |
| PubChem CID | 128551230 |
| Molecular Formula | C15H19F2NO3S |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-[(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methyl]-2,4-difluorophenol |
| SMILES | O=S1(=O)CCC2(CCCN(Cc3c(F)ccc(O)c3F)C2)C1 |
| InChI | InChI=1S/C15H19F2NO3S/c16-12-2-3-13(19)14(17)11(12)8-18-6-1-4-15(9-18)5-7-22(20,21)10-15/h2-3,19H,1,4-10H2 |
| InChIKey | CSLLQMIUVVCNKG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methyl]-2,4-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methyl]-2,4-difluorophenol?
The IUPAC name of 3-[(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methyl]-2,4-difluorophenol (CID 128551230) is 3-[(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methyl]-2,4-difluorophenol.
What is the SMILES notation for 3-[(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methyl]-2,4-difluorophenol?
The canonical SMILES for 3-[(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methyl]-2,4-difluorophenol is O=S1(=O)CCC2(CCCN(Cc3c(F)ccc(O)c3F)C2)C1.
What is the InChIKey of 3-[(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methyl]-2,4-difluorophenol?
The InChIKey is CSLLQMIUVVCNKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F2NO3S/c16-12-2-3-13(19)14(17)11(12)8-18-6-1-4-15(9-18)5-7-22(20,21)10-15/h2-3,19H,1,4-10H2.
What are the key properties of 3-[(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methyl]-2,4-difluorophenol?
3-[(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methyl]-2,4-difluorophenol has a molecular weight of 331.38 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methyl]-2,4-difluorophenol is sourced from PubChem (CID 128551230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).