C17H24N6OS — CID 128555097
(1-methyl-4,5,6,7-tetrahydroindazol-3-yl)-[4-(3-methyl-1,2,4-thiadiazol-5-yl)-1,4-diazepan-1-yl]methanone (PubChem CID 128555097) has the molecular formula C17H24N6OS and a molecular weight of 360.49 g/mol. Its IUPAC name is (1-methyl-4,5,6,7-tetrahydroindazol-3-yl)-[4-(3-methyl-1,2,4-thiadiazol-5-yl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (1-methyl-4,5,6,7-tetrahydroindazol-3-yl)-[4-(3-methyl-1,2,4-thiadiazol-5-yl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 128555097 |
| Molecular Formula | C17H24N6OS |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (1-methyl-4,5,6,7-tetrahydroindazol-3-yl)-[4-(3-methyl-1,2,4-thiadiazol-5-yl)-1,4-diazepan-1-yl]methanone |
| SMILES | Cc1nsc(N2CCCN(C(=O)c3nn(C)c4c3CCCC4)CC2)n1 |
| InChI | InChI=1S/C17H24N6OS/c1-12-18-17(25-20-12)23-9-5-8-22(10-11-23)16(24)15-13-6-3-4-7-14(13)21(2)19-15/h3-11H2,1-2H3 |
| InChIKey | HHPORPHLOHQCPT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |