C16H19N5O — CID 128559946
N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-4-pyrazin-2-ylpyrimidin-2-amine (PubChem CID 128559946) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-4-pyrazin-2-ylpyrimidin-2-amine.
| Compound Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-4-pyrazin-2-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 128559946 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-4-pyrazin-2-ylpyrimidin-2-amine |
| SMILES | c1cnc(-c2ccnc(NC3CCCC4OCCC34)n2)cn1 |
| InChI | InChI=1S/C16H19N5O/c1-2-12(11-5-9-22-15(11)3-1)20-16-19-6-4-13(21-16)14-10-17-7-8-18-14/h4,6-8,10-12,15H,1-3,5,9H2,(H,19,20,21) |
| InChIKey | UNAJOZGFUPUKGF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |