About N,N-dioctyloctan-1-amine;trifluoromethanesulfonic acid
N,N-dioctyloctan-1-amine;trifluoromethanesulfonic acid (PubChem CID 12856127) has the molecular formula C25H52F3NO3S
and a molecular weight of 503.76 g/mol. Its IUPAC name is N,N-dioctyloctan-1-amine;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | N,N-dioctyloctan-1-amine;trifluoromethanesulfonic acid |
| PubChem CID | 12856127 |
| Molecular Formula | C25H52F3NO3S |
| Molecular Weight | 503.76 g/mol |
| Exact Mass | 503.36 |
| IUPAC Name | N,N-dioctyloctan-1-amine;trifluoromethanesulfonic acid |
| SMILES | CCCCCCCCN(CCCCCCCC)CCCCCCCC.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C24H51N.CHF3O3S/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;2-1(3,4)8(5,6)7/h4-24H2,1-3H3;(H,5,6,7) |
| InChIKey | NWZNCSVMUWDGTB-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.76 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze N,N-dioctyloctan-1-amine;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dioctyloctan-1-amine;trifluoromethanesulfonic acid?
The IUPAC name of N,N-dioctyloctan-1-amine;trifluoromethanesulfonic acid (CID 12856127) is N,N-dioctyloctan-1-amine;trifluoromethanesulfonic acid.
What is the SMILES notation for N,N-dioctyloctan-1-amine;trifluoromethanesulfonic acid?
The canonical SMILES for N,N-dioctyloctan-1-amine;trifluoromethanesulfonic acid is CCCCCCCCN(CCCCCCCC)CCCCCCCC.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of N,N-dioctyloctan-1-amine;trifluoromethanesulfonic acid?
The InChIKey is NWZNCSVMUWDGTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51N.CHF3O3S/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;2-1(3,4)8(5,6)7/h4-24H2,1-3H3;(H,5,6,7).
What are the key properties of N,N-dioctyloctan-1-amine;trifluoromethanesulfonic acid?
N,N-dioctyloctan-1-amine;trifluoromethanesulfonic acid has a molecular weight of 503.76 g/mol, XLogP of 8.76, 21 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dioctyloctan-1-amine;trifluoromethanesulfonic acid is sourced from PubChem (CID 12856127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).