C14H7N5OS — CID 1285614
3-amino-5-oxo-7-phenyl-[1,3]thiazolo[3,2-a]pyrimidine-2,6-dicarbonitrile (PubChem CID 1285614) has the molecular formula C14H7N5OS and a molecular weight of 293.31 g/mol. Its IUPAC name is 3-amino-5-oxo-7-phenyl-[1,3]thiazolo[3,2-a]pyrimidine-2,6-dicarbonitrile.
| Compound Name | 3-amino-5-oxo-7-phenyl-[1,3]thiazolo[3,2-a]pyrimidine-2,6-dicarbonitrile |
|---|---|
| PubChem CID | 1285614 |
| Molecular Formula | C14H7N5OS |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 3-amino-5-oxo-7-phenyl-[1,3]thiazolo[3,2-a]pyrimidine-2,6-dicarbonitrile |
| SMILES | N#Cc1sc2nc(-c3ccccc3)c(C#N)c(=O)n2c1N |
| InChI | InChI=1S/C14H7N5OS/c15-6-9-11(8-4-2-1-3-5-8)18-14-19(13(9)20)12(17)10(7-16)21-14/h1-5H,17H2 |
| InChIKey | PXVBEEREWBHLHD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|