C11H17N3O2S — CID 12856243
methyl 4-amino-2-(azepan-1-yl)-1,3-thiazole-5-carboxylate (PubChem CID 12856243) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is methyl 4-amino-2-(azepan-1-yl)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-amino-2-(azepan-1-yl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 12856243 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | methyl 4-amino-2-(azepan-1-yl)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N2CCCCCC2)nc1N |
| InChI | InChI=1S/C11H17N3O2S/c1-16-10(15)8-9(12)13-11(17-8)14-6-4-2-3-5-7-14/h2-7,12H2,1H3 |
| InChIKey | GGAYPBMBKWDGEA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |