About [(1R,3S)-3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]cyclopentyl]methanol
[(1R,3S)-3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]cyclopentyl]methanol (PubChem CID 128563009) has the molecular formula C15H24N4O
and a molecular weight of 276.38 g/mol. Its IUPAC name is [(1R,3S)-3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]cyclopentyl]methanol.
Molecular Properties
| Compound Name | [(1R,3S)-3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]cyclopentyl]methanol |
| PubChem CID | 128563009 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | [(1R,3S)-3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]cyclopentyl]methanol |
| SMILES | OC[C@@H]1CC[C@H](Nc2ccnc(N3CCCCC3)n2)C1 |
| InChI | InChI=1S/C15H24N4O/c20-11-12-4-5-13(10-12)17-14-6-7-16-15(18-14)19-8-2-1-3-9-19/h6-7,12-13,20H,1-5,8-11H2,(H,16,17,18)/t12-,13+/m1/s1 |
| InChIKey | ATZKLIZCCWQHDH-OLZOCXBDSA-N |
| XLogP | 2.04 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1R,3S)-3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,3S)-3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]cyclopentyl]methanol?
The IUPAC name of [(1R,3S)-3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]cyclopentyl]methanol (CID 128563009) is [(1R,3S)-3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]cyclopentyl]methanol.
What is the SMILES notation for [(1R,3S)-3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]cyclopentyl]methanol?
The canonical SMILES for [(1R,3S)-3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]cyclopentyl]methanol is OC[C@@H]1CC[C@H](Nc2ccnc(N3CCCCC3)n2)C1.
What is the InChIKey of [(1R,3S)-3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]cyclopentyl]methanol?
The InChIKey is ATZKLIZCCWQHDH-OLZOCXBDSA-N. The full InChI is InChI=1S/C15H24N4O/c20-11-12-4-5-13(10-12)17-14-6-7-16-15(18-14)19-8-2-1-3-9-19/h6-7,12-13,20H,1-5,8-11H2,(H,16,17,18)/t12-,13+/m1/s1.
What are the key properties of [(1R,3S)-3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]cyclopentyl]methanol?
[(1R,3S)-3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]cyclopentyl]methanol has a molecular weight of 276.38 g/mol, XLogP of 2.04, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,3S)-3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]cyclopentyl]methanol is sourced from PubChem (CID 128563009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).