About 4-tert-butyl-1,1-dimethylpiperazin-1-ium
4-tert-butyl-1,1-dimethylpiperazin-1-ium (PubChem CID 12856634) has the molecular formula C10H23N2+
and a molecular weight of 171.31 g/mol. Its IUPAC name is 4-tert-butyl-1,1-dimethylpiperazin-1-ium.
Molecular Properties
| Compound Name | 4-tert-butyl-1,1-dimethylpiperazin-1-ium |
| PubChem CID | 12856634 |
| Molecular Formula | C10H23N2+ |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.19 |
| IUPAC Name | 4-tert-butyl-1,1-dimethylpiperazin-1-ium |
| SMILES | CC(C)(C)N1CC[N+](C)(C)CC1 |
| InChI | InChI=1S/C10H23N2/c1-10(2,3)11-6-8-12(4,5)9-7-11/h6-9H2,1-5H3/q+1 |
| InChIKey | AVLJCJPKTONJNL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-1,1-dimethylpiperazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1,1-dimethylpiperazin-1-ium?
The IUPAC name of 4-tert-butyl-1,1-dimethylpiperazin-1-ium (CID 12856634) is 4-tert-butyl-1,1-dimethylpiperazin-1-ium.
What is the SMILES notation for 4-tert-butyl-1,1-dimethylpiperazin-1-ium?
The canonical SMILES for 4-tert-butyl-1,1-dimethylpiperazin-1-ium is CC(C)(C)N1CC[N+](C)(C)CC1.
What is the InChIKey of 4-tert-butyl-1,1-dimethylpiperazin-1-ium?
The InChIKey is AVLJCJPKTONJNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N2/c1-10(2,3)11-6-8-12(4,5)9-7-11/h6-9H2,1-5H3/q+1.
What are the key properties of 4-tert-butyl-1,1-dimethylpiperazin-1-ium?
4-tert-butyl-1,1-dimethylpiperazin-1-ium has a molecular weight of 171.31 g/mol, XLogP of 1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1,1-dimethylpiperazin-1-ium is sourced from PubChem (CID 12856634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).