About 1-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-naphthyridine
1-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-naphthyridine (PubChem CID 128568465) has the molecular formula C14H18N4O2S
and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-naphthyridine.
Molecular Properties
| Compound Name | 1-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-naphthyridine |
| PubChem CID | 128568465 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-naphthyridine |
| SMILES | CCn1cc(S(=O)(=O)N2CCCc3ncccc32)nc1C |
| InChI | InChI=1S/C14H18N4O2S/c1-3-17-10-14(16-11(17)2)21(19,20)18-9-5-6-12-13(18)7-4-8-15-12/h4,7-8,10H,3,5-6,9H2,1-2H3 |
| InChIKey | NANYXQLVGWLFSB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-naphthyridine?
The IUPAC name of 1-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-naphthyridine (CID 128568465) is 1-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-naphthyridine.
What is the SMILES notation for 1-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-naphthyridine?
The canonical SMILES for 1-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-naphthyridine is CCn1cc(S(=O)(=O)N2CCCc3ncccc32)nc1C.
What is the InChIKey of 1-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-naphthyridine?
The InChIKey is NANYXQLVGWLFSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O2S/c1-3-17-10-14(16-11(17)2)21(19,20)18-9-5-6-12-13(18)7-4-8-15-12/h4,7-8,10H,3,5-6,9H2,1-2H3.
What are the key properties of 1-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-naphthyridine?
1-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-naphthyridine has a molecular weight of 306.39 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-naphthyridine is sourced from PubChem (CID 128568465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).