About 6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]heptanoic acid
6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]heptanoic acid (PubChem CID 12857128) has the molecular formula C15H23NO5
and a molecular weight of 297.35 g/mol. Its IUPAC name is 6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]heptanoic acid.
Molecular Properties
| Compound Name | 6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]heptanoic acid |
| PubChem CID | 12857128 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]heptanoic acid |
| SMILES | CC(CCCCC(=O)O)NCC(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H23NO5/c1-10(4-2-3-5-15(20)21)16-9-14(19)11-6-7-12(17)13(18)8-11/h6-8,10,14,16-19H,2-5,9H2,1H3,(H,20,21) |
| InChIKey | SZNNLLQGFHHGFD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]heptanoic acid?
The IUPAC name of 6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]heptanoic acid (CID 12857128) is 6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]heptanoic acid.
What is the SMILES notation for 6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]heptanoic acid?
The canonical SMILES for 6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]heptanoic acid is CC(CCCCC(=O)O)NCC(O)c1ccc(O)c(O)c1.
What is the InChIKey of 6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]heptanoic acid?
The InChIKey is SZNNLLQGFHHGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO5/c1-10(4-2-3-5-15(20)21)16-9-14(19)11-6-7-12(17)13(18)8-11/h6-8,10,14,16-19H,2-5,9H2,1H3,(H,20,21).
What are the key properties of 6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]heptanoic acid?
6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]heptanoic acid has a molecular weight of 297.35 g/mol, XLogP of 1.75, 9 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]heptanoic acid is sourced from PubChem (CID 12857128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).