About 4-(aminomethyl)-6,7-dichloro-2-ethyl-2,3-dihydro-1H-inden-5-ol;hydrochloride
4-(aminomethyl)-6,7-dichloro-2-ethyl-2,3-dihydro-1H-inden-5-ol;hydrochloride (PubChem CID 12857223) has the molecular formula C12H16Cl3NO
and a molecular weight of 296.62 g/mol. Its IUPAC name is 4-(aminomethyl)-6,7-dichloro-2-ethyl-2,3-dihydro-1H-inden-5-ol;hydrochloride.
Molecular Properties
| Compound Name | 4-(aminomethyl)-6,7-dichloro-2-ethyl-2,3-dihydro-1H-inden-5-ol;hydrochloride |
| PubChem CID | 12857223 |
| Molecular Formula | C12H16Cl3NO |
| Molecular Weight | 296.62 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 4-(aminomethyl)-6,7-dichloro-2-ethyl-2,3-dihydro-1H-inden-5-ol;hydrochloride |
| SMILES | CCC1Cc2c(Cl)c(Cl)c(O)c(CN)c2C1.Cl |
| InChI | InChI=1S/C12H15Cl2NO.ClH/c1-2-6-3-7-8(4-6)10(13)11(14)12(16)9(7)5-15;/h6,16H,2-5,15H2,1H3;1H |
| InChIKey | UWULZJRJYJBUTJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.62 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 4-(aminomethyl)-6,7-dichloro-2-ethyl-2,3-dihydro-1H-inden-5-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-6,7-dichloro-2-ethyl-2,3-dihydro-1H-inden-5-ol;hydrochloride?
The IUPAC name of 4-(aminomethyl)-6,7-dichloro-2-ethyl-2,3-dihydro-1H-inden-5-ol;hydrochloride (CID 12857223) is 4-(aminomethyl)-6,7-dichloro-2-ethyl-2,3-dihydro-1H-inden-5-ol;hydrochloride.
What is the SMILES notation for 4-(aminomethyl)-6,7-dichloro-2-ethyl-2,3-dihydro-1H-inden-5-ol;hydrochloride?
The canonical SMILES for 4-(aminomethyl)-6,7-dichloro-2-ethyl-2,3-dihydro-1H-inden-5-ol;hydrochloride is CCC1Cc2c(Cl)c(Cl)c(O)c(CN)c2C1.Cl.
What is the InChIKey of 4-(aminomethyl)-6,7-dichloro-2-ethyl-2,3-dihydro-1H-inden-5-ol;hydrochloride?
The InChIKey is UWULZJRJYJBUTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2NO.ClH/c1-2-6-3-7-8(4-6)10(13)11(14)12(16)9(7)5-15;/h6,16H,2-5,15H2,1H3;1H.
What are the key properties of 4-(aminomethyl)-6,7-dichloro-2-ethyl-2,3-dihydro-1H-inden-5-ol;hydrochloride?
4-(aminomethyl)-6,7-dichloro-2-ethyl-2,3-dihydro-1H-inden-5-ol;hydrochloride has a molecular weight of 296.62 g/mol, XLogP of 3.70, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-6,7-dichloro-2-ethyl-2,3-dihydro-1H-inden-5-ol;hydrochloride is sourced from PubChem (CID 12857223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).