About 3-amino-5,7-dimethyl-2,3-dihydro-1H-inden-4-ol;hydrochloride
3-amino-5,7-dimethyl-2,3-dihydro-1H-inden-4-ol;hydrochloride (PubChem CID 12857263) has the molecular formula C11H16ClNO
and a molecular weight of 213.71 g/mol. Its IUPAC name is 3-amino-5,7-dimethyl-2,3-dihydro-1H-inden-4-ol;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-5,7-dimethyl-2,3-dihydro-1H-inden-4-ol;hydrochloride |
| PubChem CID | 12857263 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 3-amino-5,7-dimethyl-2,3-dihydro-1H-inden-4-ol;hydrochloride |
| SMILES | Cc1cc(C)c2c(c1O)C(N)CC2.Cl |
| InChI | InChI=1S/C11H15NO.ClH/c1-6-5-7(2)11(13)10-8(6)3-4-9(10)12;/h5,9,13H,3-4,12H2,1-2H3;1H |
| InChIKey | ZUZWESARKRUOLI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5,7-dimethyl-2,3-dihydro-1H-inden-4-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5,7-dimethyl-2,3-dihydro-1H-inden-4-ol;hydrochloride?
The IUPAC name of 3-amino-5,7-dimethyl-2,3-dihydro-1H-inden-4-ol;hydrochloride (CID 12857263) is 3-amino-5,7-dimethyl-2,3-dihydro-1H-inden-4-ol;hydrochloride.
What is the SMILES notation for 3-amino-5,7-dimethyl-2,3-dihydro-1H-inden-4-ol;hydrochloride?
The canonical SMILES for 3-amino-5,7-dimethyl-2,3-dihydro-1H-inden-4-ol;hydrochloride is Cc1cc(C)c2c(c1O)C(N)CC2.Cl.
What is the InChIKey of 3-amino-5,7-dimethyl-2,3-dihydro-1H-inden-4-ol;hydrochloride?
The InChIKey is ZUZWESARKRUOLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO.ClH/c1-6-5-7(2)11(13)10-8(6)3-4-9(10)12;/h5,9,13H,3-4,12H2,1-2H3;1H.
What are the key properties of 3-amino-5,7-dimethyl-2,3-dihydro-1H-inden-4-ol;hydrochloride?
3-amino-5,7-dimethyl-2,3-dihydro-1H-inden-4-ol;hydrochloride has a molecular weight of 213.71 g/mol, XLogP of 2.38, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5,7-dimethyl-2,3-dihydro-1H-inden-4-ol;hydrochloride is sourced from PubChem (CID 12857263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).