C10Cl10 — CID 12857317
1,1,2,3,4,4,5,6,7,8-decachloronaphthalene (PubChem CID 12857317) has the molecular formula C10Cl10 and a molecular weight of 474.64 g/mol. Its IUPAC name is 1,1,2,3,4,4,5,6,7,8-decachloronaphthalene.
| Compound Name | 1,1,2,3,4,4,5,6,7,8-decachloronaphthalene |
|---|---|
| PubChem CID | 12857317 |
| Molecular Formula | C10Cl10 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 469.69 |
| IUPAC Name | 1,1,2,3,4,4,5,6,7,8-decachloronaphthalene |
| SMILES | ClC1=C(Cl)C(Cl)(Cl)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1(Cl)Cl |
| InChI | InChI=1S/C10Cl10/c11-3-1-2(4(12)6(14)5(3)13)10(19,20)8(16)7(15)9(1,17)18 |
| InChIKey | WYCPCMTWSJGXLE-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|