C14Cl12 — CID 12857328
1,2,3,4,5,6,7,8,9,9,10,10-dodecachlorophenanthrene (PubChem CID 12857328) has the molecular formula C14Cl12 and a molecular weight of 593.59 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,9,9,10,10-dodecachlorophenanthrene.
| Compound Name | 1,2,3,4,5,6,7,8,9,9,10,10-dodecachlorophenanthrene |
|---|---|
| PubChem CID | 12857328 |
| Molecular Formula | C14Cl12 |
| Molecular Weight | 593.59 g/mol |
| Exact Mass | 587.63 |
| IUPAC Name | 1,2,3,4,5,6,7,8,9,9,10,10-dodecachlorophenanthrene |
| SMILES | Clc1c(Cl)c(Cl)c2c(c1Cl)-c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(Cl)(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C14Cl12/c15-5-1-2-4(8(18)12(22)10(20)6(2)16)14(25,26)13(23,24)3(1)7(17)11(21)9(5)19 |
| InChIKey | CTNMPLIPVOUPCD-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.59 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|