About 1-[2-[di(propan-2-yl)amino]ethyl]-1-(4-methoxy-2-pyridinyl)-3,3-dimethylurea
1-[2-[di(propan-2-yl)amino]ethyl]-1-(4-methoxy-2-pyridinyl)-3,3-dimethylurea (PubChem CID 12857652) has the molecular formula C17H30N4O2
and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-1-(4-methoxy-2-pyridinyl)-3,3-dimethylurea.
Molecular Properties
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-1-(4-methoxy-2-pyridinyl)-3,3-dimethylurea |
| PubChem CID | 12857652 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-1-(4-methoxy-2-pyridinyl)-3,3-dimethylurea |
| SMILES | COc1ccnc(N(CCN(C(C)C)C(C)C)C(=O)N(C)C)c1 |
| InChI | InChI=1S/C17H30N4O2/c1-13(2)20(14(3)4)10-11-21(17(22)19(5)6)16-12-15(23-7)8-9-18-16/h8-9,12-14H,10-11H2,1-7H3 |
| InChIKey | MFFSEBAFEVGOAY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-[di(propan-2-yl)amino]ethyl]-1-(4-methoxy-2-pyridinyl)-3,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[di(propan-2-yl)amino]ethyl]-1-(4-methoxy-2-pyridinyl)-3,3-dimethylurea?
The IUPAC name of 1-[2-[di(propan-2-yl)amino]ethyl]-1-(4-methoxy-2-pyridinyl)-3,3-dimethylurea (CID 12857652) is 1-[2-[di(propan-2-yl)amino]ethyl]-1-(4-methoxy-2-pyridinyl)-3,3-dimethylurea.
What is the SMILES notation for 1-[2-[di(propan-2-yl)amino]ethyl]-1-(4-methoxy-2-pyridinyl)-3,3-dimethylurea?
The canonical SMILES for 1-[2-[di(propan-2-yl)amino]ethyl]-1-(4-methoxy-2-pyridinyl)-3,3-dimethylurea is COc1ccnc(N(CCN(C(C)C)C(C)C)C(=O)N(C)C)c1.
What is the InChIKey of 1-[2-[di(propan-2-yl)amino]ethyl]-1-(4-methoxy-2-pyridinyl)-3,3-dimethylurea?
The InChIKey is MFFSEBAFEVGOAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N4O2/c1-13(2)20(14(3)4)10-11-21(17(22)19(5)6)16-12-15(23-7)8-9-18-16/h8-9,12-14H,10-11H2,1-7H3.
What are the key properties of 1-[2-[di(propan-2-yl)amino]ethyl]-1-(4-methoxy-2-pyridinyl)-3,3-dimethylurea?
1-[2-[di(propan-2-yl)amino]ethyl]-1-(4-methoxy-2-pyridinyl)-3,3-dimethylurea has a molecular weight of 322.45 g/mol, XLogP of 2.70, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[di(propan-2-yl)amino]ethyl]-1-(4-methoxy-2-pyridinyl)-3,3-dimethylurea is sourced from PubChem (CID 12857652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).