About 1-(4,6-dimethyl-2-pyridinyl)-1-[4-[di(propan-2-yl)amino]butyl]-3,3-dimethylurea
1-(4,6-dimethyl-2-pyridinyl)-1-[4-[di(propan-2-yl)amino]butyl]-3,3-dimethylurea (PubChem CID 12857678) has the molecular formula C20H36N4O
and a molecular weight of 348.54 g/mol. Its IUPAC name is 1-(4,6-dimethyl-2-pyridinyl)-1-[4-[di(propan-2-yl)amino]butyl]-3,3-dimethylurea.
Molecular Properties
| Compound Name | 1-(4,6-dimethyl-2-pyridinyl)-1-[4-[di(propan-2-yl)amino]butyl]-3,3-dimethylurea |
| PubChem CID | 12857678 |
| Molecular Formula | C20H36N4O |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.29 |
| IUPAC Name | 1-(4,6-dimethyl-2-pyridinyl)-1-[4-[di(propan-2-yl)amino]butyl]-3,3-dimethylurea |
| SMILES | Cc1cc(C)nc(N(CCCCN(C(C)C)C(C)C)C(=O)N(C)C)c1 |
| InChI | InChI=1S/C20H36N4O/c1-15(2)23(16(3)4)11-9-10-12-24(20(25)22(7)8)19-14-17(5)13-18(6)21-19/h13-16H,9-12H2,1-8H3 |
| InChIKey | ANPGFGUFLFDOCX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,6-dimethyl-2-pyridinyl)-1-[4-[di(propan-2-yl)amino]butyl]-3,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethyl-2-pyridinyl)-1-[4-[di(propan-2-yl)amino]butyl]-3,3-dimethylurea?
The IUPAC name of 1-(4,6-dimethyl-2-pyridinyl)-1-[4-[di(propan-2-yl)amino]butyl]-3,3-dimethylurea (CID 12857678) is 1-(4,6-dimethyl-2-pyridinyl)-1-[4-[di(propan-2-yl)amino]butyl]-3,3-dimethylurea.
What is the SMILES notation for 1-(4,6-dimethyl-2-pyridinyl)-1-[4-[di(propan-2-yl)amino]butyl]-3,3-dimethylurea?
The canonical SMILES for 1-(4,6-dimethyl-2-pyridinyl)-1-[4-[di(propan-2-yl)amino]butyl]-3,3-dimethylurea is Cc1cc(C)nc(N(CCCCN(C(C)C)C(C)C)C(=O)N(C)C)c1.
What is the InChIKey of 1-(4,6-dimethyl-2-pyridinyl)-1-[4-[di(propan-2-yl)amino]butyl]-3,3-dimethylurea?
The InChIKey is ANPGFGUFLFDOCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36N4O/c1-15(2)23(16(3)4)11-9-10-12-24(20(25)22(7)8)19-14-17(5)13-18(6)21-19/h13-16H,9-12H2,1-8H3.
What are the key properties of 1-(4,6-dimethyl-2-pyridinyl)-1-[4-[di(propan-2-yl)amino]butyl]-3,3-dimethylurea?
1-(4,6-dimethyl-2-pyridinyl)-1-[4-[di(propan-2-yl)amino]butyl]-3,3-dimethylurea has a molecular weight of 348.54 g/mol, XLogP of 4.09, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethyl-2-pyridinyl)-1-[4-[di(propan-2-yl)amino]butyl]-3,3-dimethylurea is sourced from PubChem (CID 12857678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).