About 4-(3,5-dimethylpyrazol-1-yl)-2H-triazolo[4,5-d]pyridazine
4-(3,5-dimethylpyrazol-1-yl)-2H-triazolo[4,5-d]pyridazine (PubChem CID 12857844) has the molecular formula C9H9N7
and a molecular weight of 215.22 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-2H-triazolo[4,5-d]pyridazine.
Molecular Properties
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-2H-triazolo[4,5-d]pyridazine |
| PubChem CID | 12857844 |
| Molecular Formula | C9H9N7 |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-2H-triazolo[4,5-d]pyridazine |
| SMILES | Cc1cc(C)n(-c2nncc3n[nH]nc23)n1 |
| InChI | InChI=1S/C9H9N7/c1-5-3-6(2)16(14-5)9-8-7(4-10-13-9)11-15-12-8/h3-4H,1-2H3,(H,11,12,15) |
| InChIKey | CTFHQSANWTWVRR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(3,5-dimethylpyrazol-1-yl)-2H-triazolo[4,5-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylpyrazol-1-yl)-2H-triazolo[4,5-d]pyridazine?
The IUPAC name of 4-(3,5-dimethylpyrazol-1-yl)-2H-triazolo[4,5-d]pyridazine (CID 12857844) is 4-(3,5-dimethylpyrazol-1-yl)-2H-triazolo[4,5-d]pyridazine.
What is the SMILES notation for 4-(3,5-dimethylpyrazol-1-yl)-2H-triazolo[4,5-d]pyridazine?
The canonical SMILES for 4-(3,5-dimethylpyrazol-1-yl)-2H-triazolo[4,5-d]pyridazine is Cc1cc(C)n(-c2nncc3n[nH]nc23)n1.
What is the InChIKey of 4-(3,5-dimethylpyrazol-1-yl)-2H-triazolo[4,5-d]pyridazine?
The InChIKey is CTFHQSANWTWVRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N7/c1-5-3-6(2)16(14-5)9-8-7(4-10-13-9)11-15-12-8/h3-4H,1-2H3,(H,11,12,15).
What are the key properties of 4-(3,5-dimethylpyrazol-1-yl)-2H-triazolo[4,5-d]pyridazine?
4-(3,5-dimethylpyrazol-1-yl)-2H-triazolo[4,5-d]pyridazine has a molecular weight of 215.22 g/mol, XLogP of 0.55, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylpyrazol-1-yl)-2H-triazolo[4,5-d]pyridazine is sourced from PubChem (CID 12857844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).