C18H27INO+ — CID 12857915
6-tert-butyl-8-iodo-3,3-dimethylspiro[4H-1,3-benzoxazin-3-ium-2,1'-cyclopentane] (PubChem CID 12857915) has the molecular formula C18H27INO+ and a molecular weight of 400.32 g/mol. Its IUPAC name is 6-tert-butyl-8-iodo-3,3-dimethylspiro[4H-1,3-benzoxazin-3-ium-2,1'-cyclopentane].
| Compound Name | 6-tert-butyl-8-iodo-3,3-dimethylspiro[4H-1,3-benzoxazin-3-ium-2,1'-cyclopentane] |
|---|---|
| PubChem CID | 12857915 |
| Molecular Formula | C18H27INO+ |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 6-tert-butyl-8-iodo-3,3-dimethylspiro[4H-1,3-benzoxazin-3-ium-2,1'-cyclopentane] |
| SMILES | CC(C)(C)c1cc(I)c2c(c1)C[N+](C)(C)C1(CCCC1)O2 |
| InChI | InChI=1S/C18H27INO/c1-17(2,3)14-10-13-12-20(4,5)18(8-6-7-9-18)21-16(13)15(19)11-14/h10-11H,6-9,12H2,1-5H3/q+1 |
| InChIKey | QXGCHAQBPURXSU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|