About 2-cyclopropyl-3,3-dimethyl-1-(1-methylcyclopropyl)sulfonylazetidine
2-cyclopropyl-3,3-dimethyl-1-(1-methylcyclopropyl)sulfonylazetidine (PubChem CID 128580030) has the molecular formula C12H21NO2S
and a molecular weight of 243.37 g/mol. Its IUPAC name is 2-cyclopropyl-3,3-dimethyl-1-(1-methylcyclopropyl)sulfonylazetidine.
Molecular Properties
| Compound Name | 2-cyclopropyl-3,3-dimethyl-1-(1-methylcyclopropyl)sulfonylazetidine |
| PubChem CID | 128580030 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 2-cyclopropyl-3,3-dimethyl-1-(1-methylcyclopropyl)sulfonylazetidine |
| SMILES | CC1(C)CN(S(=O)(=O)C2(C)CC2)C1C1CC1 |
| InChI | InChI=1S/C12H21NO2S/c1-11(2)8-13(10(11)9-4-5-9)16(14,15)12(3)6-7-12/h9-10H,4-8H2,1-3H3 |
| InChIKey | MPRMFOJSTYKPCA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopropyl-3,3-dimethyl-1-(1-methylcyclopropyl)sulfonylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-3,3-dimethyl-1-(1-methylcyclopropyl)sulfonylazetidine?
The IUPAC name of 2-cyclopropyl-3,3-dimethyl-1-(1-methylcyclopropyl)sulfonylazetidine (CID 128580030) is 2-cyclopropyl-3,3-dimethyl-1-(1-methylcyclopropyl)sulfonylazetidine.
What is the SMILES notation for 2-cyclopropyl-3,3-dimethyl-1-(1-methylcyclopropyl)sulfonylazetidine?
The canonical SMILES for 2-cyclopropyl-3,3-dimethyl-1-(1-methylcyclopropyl)sulfonylazetidine is CC1(C)CN(S(=O)(=O)C2(C)CC2)C1C1CC1.
What is the InChIKey of 2-cyclopropyl-3,3-dimethyl-1-(1-methylcyclopropyl)sulfonylazetidine?
The InChIKey is MPRMFOJSTYKPCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2S/c1-11(2)8-13(10(11)9-4-5-9)16(14,15)12(3)6-7-12/h9-10H,4-8H2,1-3H3.
What are the key properties of 2-cyclopropyl-3,3-dimethyl-1-(1-methylcyclopropyl)sulfonylazetidine?
2-cyclopropyl-3,3-dimethyl-1-(1-methylcyclopropyl)sulfonylazetidine has a molecular weight of 243.37 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-3,3-dimethyl-1-(1-methylcyclopropyl)sulfonylazetidine is sourced from PubChem (CID 128580030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).