About N,1-dimethyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]cyclopropane-1-sulfonamide
N,1-dimethyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]cyclopropane-1-sulfonamide (PubChem CID 128580124) has the molecular formula C12H20F3NO2S
and a molecular weight of 299.36 g/mol. Its IUPAC name is N,1-dimethyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]cyclopropane-1-sulfonamide.
Molecular Properties
| Compound Name | N,1-dimethyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]cyclopropane-1-sulfonamide |
| PubChem CID | 128580124 |
| Molecular Formula | C12H20F3NO2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N,1-dimethyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]cyclopropane-1-sulfonamide |
| SMILES | CN([C@H]1CCCC[C@H]1C(F)(F)F)S(=O)(=O)C1(C)CC1 |
| InChI | InChI=1S/C12H20F3NO2S/c1-11(7-8-11)19(17,18)16(2)10-6-4-3-5-9(10)12(13,14)15/h9-10H,3-8H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | FBQWZBNAUOGPRV-ZJUUUORDSA-N |
| XLogP | 2.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,1-dimethyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]cyclopropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-dimethyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]cyclopropane-1-sulfonamide?
The IUPAC name of N,1-dimethyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]cyclopropane-1-sulfonamide (CID 128580124) is N,1-dimethyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]cyclopropane-1-sulfonamide.
What is the SMILES notation for N,1-dimethyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]cyclopropane-1-sulfonamide?
The canonical SMILES for N,1-dimethyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]cyclopropane-1-sulfonamide is CN([C@H]1CCCC[C@H]1C(F)(F)F)S(=O)(=O)C1(C)CC1.
What is the InChIKey of N,1-dimethyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]cyclopropane-1-sulfonamide?
The InChIKey is FBQWZBNAUOGPRV-ZJUUUORDSA-N. The full InChI is InChI=1S/C12H20F3NO2S/c1-11(7-8-11)19(17,18)16(2)10-6-4-3-5-9(10)12(13,14)15/h9-10H,3-8H2,1-2H3/t9-,10+/m1/s1.
What are the key properties of N,1-dimethyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]cyclopropane-1-sulfonamide?
N,1-dimethyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]cyclopropane-1-sulfonamide has a molecular weight of 299.36 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-dimethyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]cyclopropane-1-sulfonamide is sourced from PubChem (CID 128580124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).