C8H7N3O2 — CID 12858148
5-(2-aminophenyl)-3H-1,3,4-oxadiazol-2-one (PubChem CID 12858148) has the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. Its IUPAC name is 5-(2-aminophenyl)-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-(2-aminophenyl)-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 12858148 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 5-(2-aminophenyl)-3H-1,3,4-oxadiazol-2-one |
| SMILES | Nc1ccccc1-c1n[nH]c(=O)o1 |
| InChI | InChI=1S/C8H7N3O2/c9-6-4-2-1-3-5(6)7-10-11-8(12)13-7/h1-4H,9H2,(H,11,12) |
| InChIKey | TXCJPLZFJGBEJM-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|