About 1,5-dihydro-2,4-benzodioxepine
1,5-dihydro-2,4-benzodioxepine (PubChem CID 12858227) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 1,5-dihydro-2,4-benzodioxepine.
Molecular Properties
| Compound Name | 1,5-dihydro-2,4-benzodioxepine |
| PubChem CID | 12858227 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 1,5-dihydro-2,4-benzodioxepine |
| SMILES | c1ccc2c(c1)COCOC2 |
| InChI | InChI=1S/C9H10O2/c1-2-4-9-6-11-7-10-5-8(9)3-1/h1-4H,5-7H2 |
| InChIKey | RWYYNSXVFPESMC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,5-dihydro-2,4-benzodioxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dihydro-2,4-benzodioxepine?
The IUPAC name of 1,5-dihydro-2,4-benzodioxepine (CID 12858227) is 1,5-dihydro-2,4-benzodioxepine.
What is the SMILES notation for 1,5-dihydro-2,4-benzodioxepine?
The canonical SMILES for 1,5-dihydro-2,4-benzodioxepine is c1ccc2c(c1)COCOC2.
What is the InChIKey of 1,5-dihydro-2,4-benzodioxepine?
The InChIKey is RWYYNSXVFPESMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-2-4-9-6-11-7-10-5-8(9)3-1/h1-4H,5-7H2.
What are the key properties of 1,5-dihydro-2,4-benzodioxepine?
1,5-dihydro-2,4-benzodioxepine has a molecular weight of 150.18 g/mol, XLogP of 1.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dihydro-2,4-benzodioxepine is sourced from PubChem (CID 12858227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).