C15H21NO2 — CID 128582973
(3S)-4-(2,4,5,6-tetrahydro-1H-3-benzazocin-3-yl)oxolan-3-ol (PubChem CID 128582973) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (3S)-4-(2,4,5,6-tetrahydro-1H-3-benzazocin-3-yl)oxolan-3-ol.
| Compound Name | (3S)-4-(2,4,5,6-tetrahydro-1H-3-benzazocin-3-yl)oxolan-3-ol |
|---|---|
| PubChem CID | 128582973 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (3S)-4-(2,4,5,6-tetrahydro-1H-3-benzazocin-3-yl)oxolan-3-ol |
| SMILES | O[C@@H]1COCC1N1CCCc2ccccc2CC1 |
| InChI | InChI=1S/C15H21NO2/c17-15-11-18-10-14(15)16-8-3-6-12-4-1-2-5-13(12)7-9-16/h1-2,4-5,14-15,17H,3,6-11H2/t14?,15-/m1/s1 |
| InChIKey | BJSVXAZDBQPYGN-YSSOQSIOSA-N |
| XLogP | 1.24 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |