About 2-[4-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-3-methylpiperazin-1-yl]ethanol
2-[4-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-3-methylpiperazin-1-yl]ethanol (PubChem CID 128589855) has the molecular formula C15H22N2O5S
and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-3-methylpiperazin-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-3-methylpiperazin-1-yl]ethanol |
| PubChem CID | 128589855 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-[4-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-3-methylpiperazin-1-yl]ethanol |
| SMILES | CC1CN(CCO)CCN1S(=O)(=O)c1cccc2c1OCCO2 |
| InChI | InChI=1S/C15H22N2O5S/c1-12-11-16(7-8-18)5-6-17(12)23(19,20)14-4-2-3-13-15(14)22-10-9-21-13/h2-4,12,18H,5-11H2,1H3 |
| InChIKey | MXLISHPZCPKKKL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-3-methylpiperazin-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-3-methylpiperazin-1-yl]ethanol?
The IUPAC name of 2-[4-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-3-methylpiperazin-1-yl]ethanol (CID 128589855) is 2-[4-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-3-methylpiperazin-1-yl]ethanol.
What is the SMILES notation for 2-[4-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-3-methylpiperazin-1-yl]ethanol?
The canonical SMILES for 2-[4-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-3-methylpiperazin-1-yl]ethanol is CC1CN(CCO)CCN1S(=O)(=O)c1cccc2c1OCCO2.
What is the InChIKey of 2-[4-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-3-methylpiperazin-1-yl]ethanol?
The InChIKey is MXLISHPZCPKKKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O5S/c1-12-11-16(7-8-18)5-6-17(12)23(19,20)14-4-2-3-13-15(14)22-10-9-21-13/h2-4,12,18H,5-11H2,1H3.
What are the key properties of 2-[4-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-3-methylpiperazin-1-yl]ethanol?
2-[4-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-3-methylpiperazin-1-yl]ethanol has a molecular weight of 342.42 g/mol, XLogP of 0.14, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-3-methylpiperazin-1-yl]ethanol is sourced from PubChem (CID 128589855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).