C19H18N2O3 — CID 128595879
1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindol-2-yl-(4-methyl-2-phenyl-1,3-oxazol-5-yl)methanone (PubChem CID 128595879) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindol-2-yl-(4-methyl-2-phenyl-1,3-oxazol-5-yl)methanone.
| Compound Name | 1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindol-2-yl-(4-methyl-2-phenyl-1,3-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 128595879 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindol-2-yl-(4-methyl-2-phenyl-1,3-oxazol-5-yl)methanone |
| SMILES | Cc1nc(-c2ccccc2)oc1C(=O)N1CC2C3C=CC(O3)C2C1 |
| InChI | InChI=1S/C19H18N2O3/c1-11-17(24-18(20-11)12-5-3-2-4-6-12)19(22)21-9-13-14(10-21)16-8-7-15(13)23-16/h2-8,13-16H,9-10H2,1H3 |
| InChIKey | IGCNGNLWRZDLLH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|