About 1-prop-2-ynyladamantane
1-prop-2-ynyladamantane (PubChem CID 12859733) has the molecular formula C13H18
and a molecular weight of 174.29 g/mol. Its IUPAC name is 1-prop-2-ynyladamantane.
Molecular Properties
| Compound Name | 1-prop-2-ynyladamantane |
| PubChem CID | 12859733 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 1-prop-2-ynyladamantane |
| SMILES | C#CCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C13H18/c1-2-3-13-7-10-4-11(8-13)6-12(5-10)9-13/h1,10-12H,3-9H2 |
| InChIKey | YGMWGIQNYLNHHN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-ynyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-ynyladamantane?
The IUPAC name of 1-prop-2-ynyladamantane (CID 12859733) is 1-prop-2-ynyladamantane.
What is the SMILES notation for 1-prop-2-ynyladamantane?
The canonical SMILES for 1-prop-2-ynyladamantane is C#CCC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-prop-2-ynyladamantane?
The InChIKey is YGMWGIQNYLNHHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18/c1-2-3-13-7-10-4-11(8-13)6-12(5-10)9-13/h1,10-12H,3-9H2.
What are the key properties of 1-prop-2-ynyladamantane?
1-prop-2-ynyladamantane has a molecular weight of 174.29 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-ynyladamantane is sourced from PubChem (CID 12859733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).