C20H21N5OS — CID 128605086
1-phenyl-N-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide (PubChem CID 128605086) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is 1-phenyl-N-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide.
| Compound Name | 1-phenyl-N-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 128605086 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-phenyl-N-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide |
| SMILES | O=C(Nc1nc2c(s1)CCCCC2)N1Cc2cnn(-c3ccccc3)c2C1 |
| InChI | InChI=1S/C20H21N5OS/c26-20(23-19-22-16-9-5-2-6-10-18(16)27-19)24-12-14-11-21-25(17(14)13-24)15-7-3-1-4-8-15/h1,3-4,7-8,11H,2,5-6,9-10,12-13H2,(H,22,23,26) |
| InChIKey | BATMCWHQKFGCMR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |