About (2S,5R)-2-tert-butyl-5-ethyl-5-methyl-1,3-dioxolan-4-one
(2S,5R)-2-tert-butyl-5-ethyl-5-methyl-1,3-dioxolan-4-one (PubChem CID 12860595) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is (2S,5R)-2-tert-butyl-5-ethyl-5-methyl-1,3-dioxolan-4-one.
Molecular Properties
| Compound Name | (2S,5R)-2-tert-butyl-5-ethyl-5-methyl-1,3-dioxolan-4-one |
| PubChem CID | 12860595 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (2S,5R)-2-tert-butyl-5-ethyl-5-methyl-1,3-dioxolan-4-one |
| SMILES | CC[C@@]1(C)O[C@H](C(C)(C)C)OC1=O |
| InChI | InChI=1S/C10H18O3/c1-6-10(5)7(11)12-8(13-10)9(2,3)4/h8H,6H2,1-5H3/t8-,10-/m1/s1 |
| InChIKey | BEAYQOYLQVOUKY-PSASIEDQSA-N |
| XLogP | 2.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,5R)-2-tert-butyl-5-ethyl-5-methyl-1,3-dioxolan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-2-tert-butyl-5-ethyl-5-methyl-1,3-dioxolan-4-one?
The IUPAC name of (2S,5R)-2-tert-butyl-5-ethyl-5-methyl-1,3-dioxolan-4-one (CID 12860595) is (2S,5R)-2-tert-butyl-5-ethyl-5-methyl-1,3-dioxolan-4-one.
What is the SMILES notation for (2S,5R)-2-tert-butyl-5-ethyl-5-methyl-1,3-dioxolan-4-one?
The canonical SMILES for (2S,5R)-2-tert-butyl-5-ethyl-5-methyl-1,3-dioxolan-4-one is CC[C@@]1(C)O[C@H](C(C)(C)C)OC1=O.
What is the InChIKey of (2S,5R)-2-tert-butyl-5-ethyl-5-methyl-1,3-dioxolan-4-one?
The InChIKey is BEAYQOYLQVOUKY-PSASIEDQSA-N. The full InChI is InChI=1S/C10H18O3/c1-6-10(5)7(11)12-8(13-10)9(2,3)4/h8H,6H2,1-5H3/t8-,10-/m1/s1.
What are the key properties of (2S,5R)-2-tert-butyl-5-ethyl-5-methyl-1,3-dioxolan-4-one?
(2S,5R)-2-tert-butyl-5-ethyl-5-methyl-1,3-dioxolan-4-one has a molecular weight of 186.25 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-2-tert-butyl-5-ethyl-5-methyl-1,3-dioxolan-4-one is sourced from PubChem (CID 12860595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).