C18H25N3O3 — CID 128608435
(3aS,6aR)-3,3-dimethyl-N-[4-(propanoylamino)phenyl]-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-1-carboxamide (PubChem CID 128608435) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is (3aS,6aR)-3,3-dimethyl-N-[4-(propanoylamino)phenyl]-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-1-carboxamide.
| Compound Name | (3aS,6aR)-3,3-dimethyl-N-[4-(propanoylamino)phenyl]-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 128608435 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (3aS,6aR)-3,3-dimethyl-N-[4-(propanoylamino)phenyl]-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-1-carboxamide |
| SMILES | CCC(=O)Nc1ccc(NC(=O)N2CC(C)(C)[C@@H]3COC[C@@H]32)cc1 |
| InChI | InChI=1S/C18H25N3O3/c1-4-16(22)19-12-5-7-13(8-6-12)20-17(23)21-11-18(2,3)14-9-24-10-15(14)21/h5-8,14-15H,4,9-11H2,1-3H3,(H,19,22)(H,20,23)/t14-,15+/m1/s1 |
| InChIKey | QGEDZXVAIQFHCY-CABCVRRESA-N |
| XLogP | 2.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |