About (2-aminophenyl) benzoate
(2-aminophenyl) benzoate (PubChem CID 12860881) has the molecular formula C13H11NO2
and a molecular weight of 213.24 g/mol. Its IUPAC name is (2-aminophenyl) benzoate.
Molecular Properties
| Compound Name | (2-aminophenyl) benzoate |
| PubChem CID | 12860881 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | (2-aminophenyl) benzoate |
| SMILES | Nc1ccccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H11NO2/c14-11-8-4-5-9-12(11)16-13(15)10-6-2-1-3-7-10/h1-9H,14H2 |
| InChIKey | NFPHUVYTLYGKPU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-aminophenyl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminophenyl) benzoate?
The IUPAC name of (2-aminophenyl) benzoate (CID 12860881) is (2-aminophenyl) benzoate.
What is the SMILES notation for (2-aminophenyl) benzoate?
The canonical SMILES for (2-aminophenyl) benzoate is Nc1ccccc1OC(=O)c1ccccc1.
What is the InChIKey of (2-aminophenyl) benzoate?
The InChIKey is NFPHUVYTLYGKPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2/c14-11-8-4-5-9-12(11)16-13(15)10-6-2-1-3-7-10/h1-9H,14H2.
What are the key properties of (2-aminophenyl) benzoate?
(2-aminophenyl) benzoate has a molecular weight of 213.24 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminophenyl) benzoate is sourced from PubChem (CID 12860881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).