About ethyl 2-[3-benzyl-4-[(3-nitrophenyl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate
ethyl 2-[3-benzyl-4-[(3-nitrophenyl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate (PubChem CID 1286096) has the molecular formula C20H19N5O5
and a molecular weight of 409.40 g/mol. Its IUPAC name is ethyl 2-[3-benzyl-4-[(3-nitrophenyl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[3-benzyl-4-[(3-nitrophenyl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate |
| PubChem CID | 1286096 |
| Molecular Formula | C20H19N5O5 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | ethyl 2-[3-benzyl-4-[(3-nitrophenyl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1nc(Cc2ccccc2)n(N=Cc2cccc([N+](=O)[O-])c2)c1=O |
| InChI | InChI=1S/C20H19N5O5/c1-2-30-19(26)14-23-20(27)24(18(22-23)12-15-7-4-3-5-8-15)21-13-16-9-6-10-17(11-16)25(28)29/h3-11,13H,2,12,14H2,1H3 |
| InChIKey | SDMZZHUKRBFJHS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 121.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[3-benzyl-4-[(3-nitrophenyl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-benzyl-4-[(3-nitrophenyl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate?
The IUPAC name of ethyl 2-[3-benzyl-4-[(3-nitrophenyl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate (CID 1286096) is ethyl 2-[3-benzyl-4-[(3-nitrophenyl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate.
What is the SMILES notation for ethyl 2-[3-benzyl-4-[(3-nitrophenyl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate?
The canonical SMILES for ethyl 2-[3-benzyl-4-[(3-nitrophenyl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate is CCOC(=O)Cn1nc(Cc2ccccc2)n(N=Cc2cccc([N+](=O)[O-])c2)c1=O.
What is the InChIKey of ethyl 2-[3-benzyl-4-[(3-nitrophenyl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate?
The InChIKey is SDMZZHUKRBFJHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N5O5/c1-2-30-19(26)14-23-20(27)24(18(22-23)12-15-7-4-3-5-8-15)21-13-16-9-6-10-17(11-16)25(28)29/h3-11,13H,2,12,14H2,1H3.
What are the key properties of ethyl 2-[3-benzyl-4-[(3-nitrophenyl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate?
ethyl 2-[3-benzyl-4-[(3-nitrophenyl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate has a molecular weight of 409.40 g/mol, XLogP of 1.99, 8 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-benzyl-4-[(3-nitrophenyl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate is sourced from PubChem (CID 1286096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).