C14H13NO3 — CID 12861075
13,15-dioxa-7-azatetracyclo[8.7.0.02,6.012,16]heptadeca-1(17),2(6),10,12(16)-tetraen-3-one (PubChem CID 12861075) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is 13,15-dioxa-7-azatetracyclo[8.7.0.02,6.012,16]heptadeca-1(17),2(6),10,12(16)-tetraen-3-one.
| Compound Name | 13,15-dioxa-7-azatetracyclo[8.7.0.02,6.012,16]heptadeca-1(17),2(6),10,12(16)-tetraen-3-one |
|---|---|
| PubChem CID | 12861075 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 13,15-dioxa-7-azatetracyclo[8.7.0.02,6.012,16]heptadeca-1(17),2(6),10,12(16)-tetraen-3-one |
| SMILES | O=C1CCC2=C1c1cc3c(cc1CCN2)OCO3 |
| InChI | InChI=1S/C14H13NO3/c16-11-2-1-10-14(11)9-6-13-12(17-7-18-13)5-8(9)3-4-15-10/h5-6,15H,1-4,7H2 |
| InChIKey | ZRUHUGDKUSRMSY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |