C31H23NO2 — CID 12861079
2-methyl-4-phenyl-2-(1,2,3-triphenylcycloprop-2-en-1-yl)-1,3-oxazol-5-one (PubChem CID 12861079) has the molecular formula C31H23NO2 and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-methyl-4-phenyl-2-(1,2,3-triphenylcycloprop-2-en-1-yl)-1,3-oxazol-5-one.
| Compound Name | 2-methyl-4-phenyl-2-(1,2,3-triphenylcycloprop-2-en-1-yl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 12861079 |
| Molecular Formula | C31H23NO2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-methyl-4-phenyl-2-(1,2,3-triphenylcycloprop-2-en-1-yl)-1,3-oxazol-5-one |
| SMILES | CC1(C2(c3ccccc3)C(c3ccccc3)=C2c2ccccc2)N=C(c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C31H23NO2/c1-30(32-28(29(33)34-30)24-18-10-4-11-19-24)31(25-20-12-5-13-21-25)26(22-14-6-2-7-15-22)27(31)23-16-8-3-9-17-23/h2-21H,1H3 |
| InChIKey | ZDYTXNDDYHFVCT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|