C9H10O — CID 12861313
3,3a,4,6a-tetrahydropentalene-1-carbaldehyde (PubChem CID 12861313) has the molecular formula C9H10O and a molecular weight of 134.18 g/mol. Its IUPAC name is 3,3a,4,6a-tetrahydropentalene-1-carbaldehyde.
| Compound Name | 3,3a,4,6a-tetrahydropentalene-1-carbaldehyde |
|---|---|
| PubChem CID | 12861313 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 3,3a,4,6a-tetrahydropentalene-1-carbaldehyde |
| SMILES | O=CC1=CCC2CC=CC12 |
| InChI | InChI=1S/C9H10O/c10-6-8-5-4-7-2-1-3-9(7)8/h1,3,5-7,9H,2,4H2 |
| InChIKey | HGDCWDICISOKQK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|