About spiro[cyclohexane-1,9'-xanthene]
spiro[cyclohexane-1,9'-xanthene] (PubChem CID 12861604) has the molecular formula C18H18O
and a molecular weight of 250.34 g/mol. Its IUPAC name is spiro[cyclohexane-1,9'-xanthene].
Molecular Properties
| Compound Name | spiro[cyclohexane-1,9'-xanthene] |
| PubChem CID | 12861604 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | spiro[cyclohexane-1,9'-xanthene] |
| SMILES | c1ccc2c(c1)Oc1ccccc1C21CCCCC1 |
| InChI | InChI=1S/C18H18O/c1-6-12-18(13-7-1)14-8-2-4-10-16(14)19-17-11-5-3-9-15(17)18/h2-5,8-11H,1,6-7,12-13H2 |
| InChIKey | IXHWJOFFTAICML-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[cyclohexane-1,9'-xanthene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[cyclohexane-1,9'-xanthene]?
The IUPAC name of spiro[cyclohexane-1,9'-xanthene] (CID 12861604) is spiro[cyclohexane-1,9'-xanthene].
What is the SMILES notation for spiro[cyclohexane-1,9'-xanthene]?
The canonical SMILES for spiro[cyclohexane-1,9'-xanthene] is c1ccc2c(c1)Oc1ccccc1C21CCCCC1.
What is the InChIKey of spiro[cyclohexane-1,9'-xanthene]?
The InChIKey is IXHWJOFFTAICML-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O/c1-6-12-18(13-7-1)14-8-2-4-10-16(14)19-17-11-5-3-9-15(17)18/h2-5,8-11H,1,6-7,12-13H2.
What are the key properties of spiro[cyclohexane-1,9'-xanthene]?
spiro[cyclohexane-1,9'-xanthene] has a molecular weight of 250.34 g/mol, XLogP of 5.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[cyclohexane-1,9'-xanthene] is sourced from PubChem (CID 12861604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).