C15H20N4O3S — CID 128617173
(3aR,6aS)-N-[2-methyl-4-(2-methylpropyl)-1,3-thiazol-5-yl]-1,3-dioxo-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 128617173) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is (3aR,6aS)-N-[2-methyl-4-(2-methylpropyl)-1,3-thiazol-5-yl]-1,3-dioxo-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aR,6aS)-N-[2-methyl-4-(2-methylpropyl)-1,3-thiazol-5-yl]-1,3-dioxo-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 128617173 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (3aR,6aS)-N-[2-methyl-4-(2-methylpropyl)-1,3-thiazol-5-yl]-1,3-dioxo-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | Cc1nc(CC(C)C)c(NC(=O)N2C[C@@H]3C(=O)NC(=O)[C@@H]3C2)s1 |
| InChI | InChI=1S/C15H20N4O3S/c1-7(2)4-11-14(23-8(3)16-11)18-15(22)19-5-9-10(6-19)13(21)17-12(9)20/h7,9-10H,4-6H2,1-3H3,(H,18,22)(H,17,20,21)/t9-,10+ |
| InChIKey | SRMMBNQEIRWALQ-AOOOYVTPSA-N |
| XLogP | 1.39 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|