C21H23N3O2 — CID 128617710
(2R,6S)-N-[4-methyl-3-(4-methyl-1,3-oxazol-2-yl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-4-carboxamide (PubChem CID 128617710) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is (2R,6S)-N-[4-methyl-3-(4-methyl-1,3-oxazol-2-yl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-4-carboxamide.
| Compound Name | (2R,6S)-N-[4-methyl-3-(4-methyl-1,3-oxazol-2-yl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-4-carboxamide |
|---|---|
| PubChem CID | 128617710 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (2R,6S)-N-[4-methyl-3-(4-methyl-1,3-oxazol-2-yl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-4-carboxamide |
| SMILES | Cc1coc(-c2cc(NC(=O)N3C[C@@H]4C5C=CC(C5)[C@@H]4C3)ccc2C)n1 |
| InChI | InChI=1S/C21H23N3O2/c1-12-3-6-16(8-17(12)20-22-13(2)11-26-20)23-21(25)24-9-18-14-4-5-15(7-14)19(18)10-24/h3-6,8,11,14-15,18-19H,7,9-10H2,1-2H3,(H,23,25)/t14?,15?,18-,19+ |
| InChIKey | RPNCOMOQLMEILQ-GNSZPUGASA-N |
| XLogP | 4.24 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|