About 1,3-dimethyl-[1]benzothiolo[2,3-c]pyridine;hydrochloride
1,3-dimethyl-[1]benzothiolo[2,3-c]pyridine;hydrochloride (PubChem CID 12861805) has the molecular formula C13H12ClNS
and a molecular weight of 249.77 g/mol. Its IUPAC name is 1,3-dimethyl-[1]benzothiolo[2,3-c]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 1,3-dimethyl-[1]benzothiolo[2,3-c]pyridine;hydrochloride |
| PubChem CID | 12861805 |
| Molecular Formula | C13H12ClNS |
| Molecular Weight | 249.77 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 1,3-dimethyl-[1]benzothiolo[2,3-c]pyridine;hydrochloride |
| SMILES | Cc1cc2c(sc3ccccc32)c(C)n1.Cl |
| InChI | InChI=1S/C13H11NS.ClH/c1-8-7-11-10-5-3-4-6-12(10)15-13(11)9(2)14-8;/h3-7H,1-2H3;1H |
| InChIKey | CHQALSZTYXWPCF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.77 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dimethyl-[1]benzothiolo[2,3-c]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-[1]benzothiolo[2,3-c]pyridine;hydrochloride?
The IUPAC name of 1,3-dimethyl-[1]benzothiolo[2,3-c]pyridine;hydrochloride (CID 12861805) is 1,3-dimethyl-[1]benzothiolo[2,3-c]pyridine;hydrochloride.
What is the SMILES notation for 1,3-dimethyl-[1]benzothiolo[2,3-c]pyridine;hydrochloride?
The canonical SMILES for 1,3-dimethyl-[1]benzothiolo[2,3-c]pyridine;hydrochloride is Cc1cc2c(sc3ccccc32)c(C)n1.Cl.
What is the InChIKey of 1,3-dimethyl-[1]benzothiolo[2,3-c]pyridine;hydrochloride?
The InChIKey is CHQALSZTYXWPCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NS.ClH/c1-8-7-11-10-5-3-4-6-12(10)15-13(11)9(2)14-8;/h3-7H,1-2H3;1H.
What are the key properties of 1,3-dimethyl-[1]benzothiolo[2,3-c]pyridine;hydrochloride?
1,3-dimethyl-[1]benzothiolo[2,3-c]pyridine;hydrochloride has a molecular weight of 249.77 g/mol, XLogP of 4.49, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-[1]benzothiolo[2,3-c]pyridine;hydrochloride is sourced from PubChem (CID 12861805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).