C15H14N2O3S — CID 12862354
5-butyl-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-12-carboxylic acid (PubChem CID 12862354) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is 5-butyl-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-12-carboxylic acid.
| Compound Name | 5-butyl-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-12-carboxylic acid |
|---|---|
| PubChem CID | 12862354 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 5-butyl-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-12-carboxylic acid |
| SMILES | CCCCc1cc2c(=O)n3cc(C(=O)O)ccc3nc2s1 |
| InChI | InChI=1S/C15H14N2O3S/c1-2-3-4-10-7-11-13(21-10)16-12-6-5-9(15(19)20)8-17(12)14(11)18/h5-8H,2-4H2,1H3,(H,19,20) |
| InChIKey | HXKCKFTXWRZGPB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |